2-(diethylamino)-1-[4-[(3-nitroacridin-9-yl)amino]phenyl]ethanol
Modify Date: 2025-10-02 00:49:37
![2-(diethylamino)-1-[4-[(3-nitroacridin-9-yl)amino]phenyl]ethanol Structure](https://image.chemsrc.com/caspic/100/32951-79-4.png)
2-(diethylamino)-1-[4-[(3-nitroacridin-9-yl)amino]phenyl]ethanol structure
|
Common Name | 2-(diethylamino)-1-[4-[(3-nitroacridin-9-yl)amino]phenyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 32951-79-4 | Molecular Weight | 430.49900 | |
| Density | 1.292g/cm3 | Boiling Point | 624.2ºC at 760 mmHg | |
| Molecular Formula | C25H26N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 331.3ºC | |
| Name | 2-(diethylamino)-1-[4-[(3-nitroacridin-9-yl)amino]phenyl]ethanol |
|---|
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 624.2ºC at 760 mmHg |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.49900 |
| Flash Point | 331.3ºC |
| Exact Mass | 430.20000 |
| PSA | 97.44000 |
| LogP | 5.36010 |
| Index of Refraction | 1.703 |
| InChIKey | SBMVWWAIBUQOFO-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(O)c1ccc(Nc2c3ccccc3nc3cc([N+](=O)[O-])ccc23)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |