ditert-butyl 2-fluoro-3-oxobutanedioate
Modify Date: 2024-01-08 10:08:11
ditert-butyl 2-fluoro-3-oxobutanedioate structure
|
Common Name | ditert-butyl 2-fluoro-3-oxobutanedioate | ||
|---|---|---|---|---|
| CAS Number | 327-39-9 | Molecular Weight | 262.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19FO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ditert-butyl 2-fluoro-3-oxobutanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19FO5 |
|---|---|
| Molecular Weight | 262.27500 |
| Exact Mass | 262.12200 |
| PSA | 69.67000 |
| LogP | 1.57700 |
| InChIKey | VKDINJJAYAUQBL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(=O)C(F)C(=O)OC(C)(C)C |
| HS Code | 2918300090 |
|---|
|
~85%
ditert-butyl 2-... CAS#:327-39-9 |
| Literature: Wanner; Hageman; Koomen; Pandit Journal of Medicinal Chemistry, 1980 , vol. 23, # 1 p. 85 - 87 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| fluoro-oxalacetic acid di-tert-butyl ester |
| di-t-butyloxalofluoroacetate |
| Fluor-oxalessigsaeure-di-tert-butylester |