[phosphono(piperidin-1-yl)methyl]phosphonic acid structure
|
Common Name | [phosphono(piperidin-1-yl)methyl]phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 32545-72-5 | Molecular Weight | 259.13400 | |
| Density | 1.672g/cm3 | Boiling Point | 537.2ºC at 760 mmHg | |
| Molecular Formula | C6H15NO6P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.7ºC | |
| Name | [phosphono(piperidin-1-yl)methyl]phosphonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.672g/cm3 |
|---|---|
| Boiling Point | 537.2ºC at 760 mmHg |
| Molecular Formula | C6H15NO6P2 |
| Molecular Weight | 259.13400 |
| Flash Point | 278.7ºC |
| Exact Mass | 259.03700 |
| PSA | 137.92000 |
| LogP | 0.04920 |
| Index of Refraction | 1.573 |
| InChIKey | JTLZXDRXWWHVHX-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)C(N1CCCCC1)P(=O)(O)O |
|
~64%
[phosphono(pipe... CAS#:32545-72-5 |
| Literature: Takeuchi; Sakamoto; Yoshida; Abe; Isomura Chemical and Pharmaceutical Bulletin, 1993 , vol. 41, # 4 p. 688 - 693 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N-piperidinomethane-1,1-diphosphonic acid |
| 1-piperidinylmethylene-1,1-bisphosphonate |
| piperidine-N-methyldiphosphonic acid |
| piperidinomethane-diphosphonic acid |
| piperid-1-ylmethane-1,1-diphosphonic acid |