5-(5-prop-1-ynylthiophen-2-yl)thiophene-2-carboxylic acid structure
|
Common Name | 5-(5-prop-1-ynylthiophen-2-yl)thiophene-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 32155-99-0 | Molecular Weight | 248.32100 | |
| Density | 1.43g/cm3 | Boiling Point | 463.4ºC at 760 mmHg | |
| Molecular Formula | C12H8O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.1ºC | |
| Name | 5-(5-prop-1-ynylthiophen-2-yl)thiophene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 463.4ºC at 760 mmHg |
| Molecular Formula | C12H8O2S2 |
| Molecular Weight | 248.32100 |
| Flash Point | 234.1ºC |
| Exact Mass | 247.99700 |
| PSA | 93.78000 |
| LogP | 3.54620 |
| Index of Refraction | 1.686 |
| InChIKey | SJVJMFXCINSXFF-UHFFFAOYSA-N |
| SMILES | CC#Cc1ccc(-c2ccc(C(=O)O)s2)s1 |
|
~71%
5-(5-prop-1-yny... CAS#:32155-99-0 |
| Literature: Washino, Tsutomu; Yoshikura, Masahiro; Obata, Shigeo Agricultural and Biological Chemistry, 1986 , vol. 50, # 3 p. 565 - 568 |
|
~%
5-(5-prop-1-yny... CAS#:32155-99-0 |
| Literature: Washino, Tsutomu; Yoshikura, Masahiro; Obata, Shigeo Agricultural and Biological Chemistry, 1986 , vol. 50, # 3 p. 565 - 568 |
|
~%
5-(5-prop-1-yny... CAS#:32155-99-0 |
| Literature: Washino, Tsutomu; Yoshikura, Masahiro; Obata, Shigeo Agricultural and Biological Chemistry, 1986 , vol. 50, # 3 p. 565 - 568 |
| arctic acid |