5-(dimethylamino)-6-methyl-1-phenyl-3-prop-2-enylpyrimidine-2,4-dione
Modify Date: 2025-11-15 16:26:44
5-(dimethylamino)-6-methyl-1-phenyl-3-prop-2-enylpyrimidine-2,4-dione structure
|
Common Name | 5-(dimethylamino)-6-methyl-1-phenyl-3-prop-2-enylpyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 32150-60-0 | Molecular Weight | 285.34100 | |
| Density | 1.2g/cm3 | Boiling Point | 390.2ºC at 760mmHg | |
| Molecular Formula | C16H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.7ºC | |
| Name | 5-(dimethylamino)-6-methyl-1-phenyl-3-prop-2-enylpyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 390.2ºC at 760mmHg |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.34100 |
| Flash Point | 157.7ºC |
| Exact Mass | 285.14800 |
| PSA | 47.24000 |
| LogP | 1.55960 |
| Index of Refraction | 1.609 |
| InChIKey | IDKUACLJPBLSHH-UHFFFAOYSA-N |
| SMILES | C=CCn1c(=O)c(N(C)C)c(C)n(-c2ccccc2)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Allyl-5-dimethylamino-6-methyl-1-phenyluracil |
| 3-allyl-5-dimethylamino-6-methyl-1-phenyl-1H-pyrimidine-2,4-dione |