2,4-dichloro-6-(2-chlorophenoxy)-1,3,5-triazine
Modify Date: 2025-11-26 01:39:42
2,4-dichloro-6-(2-chlorophenoxy)-1,3,5-triazine structure
|
Common Name | 2,4-dichloro-6-(2-chlorophenoxy)-1,3,5-triazine | ||
|---|---|---|---|---|
| CAS Number | 30886-25-0 | Molecular Weight | 276.50700 | |
| Density | 1.575g/cm3 | Boiling Point | 452.9ºC at 760mmHg | |
| Molecular Formula | C9H4Cl3N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.7ºC | |
| Name | 2,4-dichloro-6-(2-chlorophenoxy)-1,3,5-triazine |
|---|
| Density | 1.575g/cm3 |
|---|---|
| Boiling Point | 452.9ºC at 760mmHg |
| Molecular Formula | C9H4Cl3N3O |
| Molecular Weight | 276.50700 |
| Flash Point | 227.7ºC |
| Exact Mass | 274.94200 |
| PSA | 47.90000 |
| LogP | 3.62410 |
| Index of Refraction | 1.619 |
| InChIKey | PJFPTKBWLCIUQU-UHFFFAOYSA-N |
| SMILES | Clc1nc(Cl)nc(Oc2ccccc2Cl)n1 |
|
~61%
2,4-dichloro-6-... CAS#:30886-25-0 |
| Literature: Shelar; Adure Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1998 , vol. 37, # 4 p. 358 - 364 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |