1,1,3,5,7,9,10-heptachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane structure
|
Common Name | 1,1,3,5,7,9,10-heptachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane | ||
|---|---|---|---|---|
| CAS Number | 307-41-5 | Molecular Weight | 653.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10Cl7F15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,3,5,7,9,10-heptachloro-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecafluorodecane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10Cl7F15 |
|---|---|
| Molecular Weight | 653.25400 |
| Exact Mass | 649.75800 |
| LogP | 9.07850 |
| InChIKey | ADXLMDOKVQZCOI-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)Cl |
|
~%
1,1,3,5,7,9,10-... CAS#:307-41-5 |
| Literature: Kellogg Co. Patent: US2742510 , 1955 ; |
|
~%
1,1,3,5,7,9,10-... CAS#:307-41-5 |
| Literature: Haszeldine Journal of the Chemical Society, 1955 , p. 4291,4300 |
| 1,1,3,5,7,9,10-heptakis(chloranyl)-1,2,2,3,4,4,5,6,6,7,8,8,9,10,10-pentadecakis(fluoranyl)decane |
| 1,1,3,5,7,9,10-heptachloro-pentadecafluoro-decane |
| 1,1,3,5,7,9,10-Heptachlor-pentadecafluor-decan |
| I14-0415 |