5-amino-N,N-dimethyl-2-prop-2-ynoxybenzamide
Modify Date: 2025-11-28 12:25:28
5-amino-N,N-dimethyl-2-prop-2-ynoxybenzamide structure
|
Common Name | 5-amino-N,N-dimethyl-2-prop-2-ynoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 30533-84-7 | Molecular Weight | 218.25200 | |
| Density | 1.162g/cm3 | Boiling Point | 431.1ºC at 760 mmHg | |
| Molecular Formula | C12H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5ºC | |
| Name | 5-amino-N,N-dimethyl-2-prop-2-ynoxybenzamide |
|---|
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760 mmHg |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.25200 |
| Flash Point | 214.5ºC |
| Exact Mass | 218.10600 |
| PSA | 55.56000 |
| LogP | 1.56380 |
| Index of Refraction | 1.581 |
| InChIKey | NUOIQFHCMUFAHH-UHFFFAOYSA-N |
| SMILES | C#CCOc1ccc(N)cc1C(=O)N(C)C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |