3-amino-6-hydroxy-1-(4-methylphenyl)hex-2-en-1-one structure
|
Common Name | 3-amino-6-hydroxy-1-(4-methylphenyl)hex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 304679-05-8 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-amino-6-hydroxy-1-(4-methylphenyl)hex-2-en-1-one |
|---|
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 63.32000 |
| LogP | 2.49310 |
| InChIKey | ZVGXPGDWIXQUNO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)C=C(N)CCCO)cc1 |
|
~%
3-amino-6-hydro... CAS#:304679-05-8 |
| Literature: Batra, Sanjay; Srivastava, Seema; Singh, Kavita; Chander, Ramesh; Khanna, Ashok K.; Bhaduri, Amiya P. Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 8 p. 2195 - 2209 |
|
~%
3-amino-6-hydro... CAS#:304679-05-8 |
| Literature: Batra, Sanjay; Srivastava, Seema; Singh, Kavita; Chander, Ramesh; Khanna, Ashok K.; Bhaduri, Amiya P. Bioorganic and Medicinal Chemistry, 2000 , vol. 8, # 8 p. 2195 - 2209 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |