2-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 30100-35-7 | Molecular Weight | 214.21700 | |
| Density | 1.243g/cm3 | Boiling Point | 370.8ºC at 760mmHg | |
| Molecular Formula | C13H10O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-methoxyphenyl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 370.8ºC at 760mmHg |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.21700 |
| Exact Mass | 214.06300 |
| PSA | 43.37000 |
| LogP | 1.78660 |
| Index of Refraction | 1.591 |
| InChIKey | LMZUGHSRDZORTH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2=CC(=O)C=CC2=O)cc1 |
| HS Code | 2922299090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-p-anisyl-1,4-benzoquinone |
| p-Anisyl-p-benzoquinone |