[2,4,5-tris(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate structure
|
Common Name | [2,4,5-tris(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 2969-16-6 | Molecular Weight | 452.45200 | |
| Density | 1.23g/cm3 | Boiling Point | 522.5ºC at 760mmHg | |
| Molecular Formula | C22H28O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.1ºC | |
| Name | [2,4,5-tris(2-methylpropanoyloxy)-3,6-dioxocyclohexa-1,4-dien-1-yl] 2-methylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 522.5ºC at 760mmHg |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.45200 |
| Flash Point | 223.1ºC |
| Exact Mass | 452.16800 |
| PSA | 139.34000 |
| LogP | 2.35820 |
| Vapour Pressure | 5.17E-11mmHg at 25°C |
| Index of Refraction | 1.505 |
| InChIKey | YJTMPPLOGFETMM-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC1=C(OC(=O)C(C)C)C(=O)C(OC(=O)C(C)C)=C(OC(=O)C(C)C)C1=O |
|
~%
[2,4,5-tris(2-m... CAS#:2969-16-6 |
| Literature: Hoglan; Bartow Journal of the American Chemical Society, 1940 , vol. 62, p. 2397,2398 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Tetrakis-isobutyryloxy-[1,4]benzochinon |
| Isobutyric acid,tetraester with 2,3,5,6-tetrahydroxy-p-benzoquinone (8CI) |
| Tetrahydroxychinon-tetraisobutyrat |
| 3,6-dioxocyclohexa-1,4-diene-1,2,4,5-tetrayl tetrakis(2-methylpropanoate) |
| tetrakis-isobutyryloxy-[1,4]benzoquinone |