Methyl (4-nitrophenyl)acetate structure
|
Common Name | Methyl (4-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 2945-08-6 | Molecular Weight | 195.172 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 308.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.9±22.9 °C | |
| Name | methyl 2-(4-nitrophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 308.6±17.0 °C at 760 mmHg |
| Molecular Formula | C9H9NO4 |
| Molecular Weight | 195.172 |
| Flash Point | 143.9±22.9 °C |
| Exact Mass | 195.053162 |
| PSA | 72.12000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | PQRGTRBYCFLHKY-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2916399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methyl p-nitrophenylacetate |
| Benzeneacetic acid,4-nitro-,methyl ester |
| UNII-QMK2BOL4OA |
| Acetic acid, (p-nitrophenyl)-, methyl ester |
| Benzeneacetic acid, 4-nitro-, methyl ester |
| Methyl (4-nitrophenyl)acetate |
| p-Nitrophenylacetic acid,methyl ester |