WRN inhibitor 5 structure
|
Common Name | WRN inhibitor 5 | ||
|---|---|---|---|---|
| CAS Number | 2923009-95-2 | Molecular Weight | 452.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H20N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WRN inhibitor 5WRN inhibitor 5 (example 157), a cyclic vinyl sulfone compound, is a Wemer Syndrome ATP dependent helicase enzyme (WRN) inhibitor. WRN inhibitor 5 can be used for the research of cancer[1]. |
| Name | WRN inhibitor 5 |
|---|
| Description | WRN inhibitor 5 (example 157), a cyclic vinyl sulfone compound, is a Wemer Syndrome ATP dependent helicase enzyme (WRN) inhibitor. WRN inhibitor 5 can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Ashley ADAMS, et al. Cyclic vinyl sulfone compounds as wrn inhibitors. Patent. WO2023062575 A1. |
| Molecular Formula | C23H20N2O6S |
|---|---|
| Molecular Weight | 452.48 |
| InChIKey | UATCHQZLFRSLIK-MRXNPFEDSA-N |
| SMILES | O=C(NC1C=CS(=O)(=O)C1)c1cc(O)c(-c2ccccc2OCc2ccccc2)[nH]c1=O |