S-(4-methylpiperazine-1-carbothioyl) phenothiazine-10-carbothioate
Modify Date: 2025-08-29 05:17:10
S-(4-methylpiperazine-1-carbothioyl) phenothiazine-10-carbothioate structure
|
Common Name | S-(4-methylpiperazine-1-carbothioyl) phenothiazine-10-carbothioate | ||
|---|---|---|---|---|
| CAS Number | 29140-79-2 | Molecular Weight | 401.56900 | |
| Density | 1.394g/cm3 | Boiling Point | 537.4ºC at 760mmHg | |
| Molecular Formula | C19H19N3OS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.8ºC | |
| Name | S-(4-methylpiperazine-1-carbothioyl) phenothiazine-10-carbothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 537.4ºC at 760mmHg |
| Molecular Formula | C19H19N3OS3 |
| Molecular Weight | 401.56900 |
| Flash Point | 278.8ºC |
| Exact Mass | 401.06900 |
| PSA | 109.48000 |
| LogP | 4.61560 |
| Vapour Pressure | 1.28E-11mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | SNSBATSRSJVRNH-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=S)SC(=O)N2c3ccccc3Sc3ccccc32)CC1 |
| Phenothiazine-10-carbothioic acid,anhydrosulfide with 4-methyl-1-piperazinecarbodithioic acid |
| phenothiazine-10-carboxylic 4-methyl-piperazine-1-carbothioic thioanhydride |
| 10H-Phenothiazine-10-carbothioicacid,anhydrosulfide with 4-methyl-1-piperazinecarbodithioic acid |
| Phenothiazine-10-carbonyl 4-methyl-1-piperazinedithiocarboxylate |