1-[2-(4-chlorophenoxy)-5-fluorophenyl]-N-methylmethanamine structure
|
Common Name | 1-[2-(4-chlorophenoxy)-5-fluorophenyl]-N-methylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 289717-57-3 | Molecular Weight | 265.71100 | |
| Density | 1.22g/cm3 | Boiling Point | 323.257ºC at 760 mmHg | |
| Molecular Formula | C14H13ClFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.301ºC | |
| Name | 1-[2-(4-chlorophenoxy)-5-fluorophenyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 323.257ºC at 760 mmHg |
| Molecular Formula | C14H13ClFNO |
| Molecular Weight | 265.71100 |
| Flash Point | 149.301ºC |
| Exact Mass | 265.06700 |
| PSA | 21.26000 |
| LogP | 4.38170 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | PMXOUAJLQYBUOO-UHFFFAOYSA-N |
| SMILES | CNCc1cc(F)ccc1Oc1ccc(Cl)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD08064240 |