(1-OH)-Exatecan structure
|
Common Name | (1-OH)-Exatecan | ||
|---|---|---|---|---|
| CAS Number | 2894780-53-9 | Molecular Weight | 436.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (1-OH)-Exatecan(1-OH)-Exatecan is a quinoline ring compound. (1-OH)-Exatecan has substantial antiproliferative effects. (1-OH)-Exatecan can be used for cancer diseases research[1]. |
| Name | (1-OH)-Exatecan |
|---|
| Description | (1-OH)-Exatecan is a quinoline ring compound. (1-OH)-Exatecan has substantial antiproliferative effects. (1-OH)-Exatecan can be used for cancer diseases research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H21FN2O5 |
|---|---|
| Molecular Weight | 436.43 |
| InChIKey | FRPSGSHVDGIPFA-UUOWRZLLSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(O)CC3 |