5-[(3-chlorophenyl)methylidene]imidazolidine-2,4-dione structure
|
Common Name | 5-[(3-chlorophenyl)methylidene]imidazolidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 28744-91-4 | Molecular Weight | 222.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(3-chlorophenyl)methylidene]imidazolidine-2,4-dione |
|---|
| Molecular Formula | C10H7ClN2O2 |
|---|---|
| Molecular Weight | 222.62800 |
| Exact Mass | 222.02000 |
| PSA | 65.18000 |
| LogP | 1.43620 |
| InChIKey | GUYDWDPNOQVEJB-YVMONPNESA-N |
| SMILES | O=C1NC(=O)C(=Cc2cccc(Cl)c2)N1 |
|
~81%
5-[(3-chlorophe... CAS#:28744-91-4 |
| Literature: Cremlyn, Richard; Jethwa, Sanjay; Joiner, Graham; White, David Phosphorus and Sulfur and the Related Elements, 1988 , vol. 36, p. 99 - 110 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |