potassium,2-nonylphenolate
Modify Date: 2025-09-24 00:27:46
potassium,2-nonylphenolate structure
|
Common Name | potassium,2-nonylphenolate | ||
|---|---|---|---|---|
| CAS Number | 27936-43-2 | Molecular Weight | 258.44100 | |
| Density | N/A | Boiling Point | 321.3ºC at 760mmHg | |
| Molecular Formula | C15H23KO | Melting Point | Freezing point: -10ºC (sets to glass below this temperature | |
| MSDS | N/A | Flash Point | 177.5ºC | |
| Name | potassium,2-nonylphenolate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 321.3ºC at 760mmHg |
|---|---|
| Melting Point | Freezing point: -10ºC (sets to glass below this temperature |
| Molecular Formula | C15H23KO |
| Molecular Weight | 258.44100 |
| Flash Point | 177.5ºC |
| Exact Mass | 258.13900 |
| PSA | 23.06000 |
| LogP | 5.12350 |
| InChIKey | XPCLSVISJWLKJE-UHFFFAOYSA-M |
| SMILES | CCCCCCCCCc1ccccc1[O-].[K+] |
| Potassium nonylphenate |
| Phenol,nonyl-,potassium salt |
| EINECS 248-740-5 |
| Potassium nonylphenolate |
| potassium 2-nonylphenolate |