3-ethyl-5-[(3-methylthiazolidin-2-ylidene)ethylidene]rhodanine structure
|
Common Name | 3-ethyl-5-[(3-methylthiazolidin-2-ylidene)ethylidene]rhodanine | ||
|---|---|---|---|---|
| CAS Number | 27930-87-6 | Molecular Weight | 286.43700 | |
| Density | 1.41g/cm3 | Boiling Point | 368.5ºC at 760mmHg | |
| Molecular Formula | C11H14N2OS3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.7ºC | |
| Name | 3-ethyl-5-[(3-methylthiazolidin-2-ylidene)ethylidene]rhodanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 368.5ºC at 760mmHg |
| Molecular Formula | C11H14N2OS3 |
| Molecular Weight | 286.43700 |
| Flash Point | 176.7ºC |
| Exact Mass | 286.02700 |
| PSA | 106.24000 |
| LogP | 2.14630 |
| Vapour Pressure | 1.27E-05mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | WBOILOFIBGGYFC-MVTUOISNSA-N |
| SMILES | CCN1C(=O)C(=CC=C2SCCN2C)SC1=S |
|
~%
3-ethyl-5-[(3-m... CAS#:27930-87-6 |
| Literature: Hamer; Rathbone Journal of the Chemical Society, 1943 , p. 243,247 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-ethyl-5-[(3-methyl-thiazolidin-2-yliden)-ethylidene]-2-thioxo-thiazolidin-4-one |
| 3-Aethyl-5-[(3-methyl-thiazolidin-2-yliden)-aethyliden]-2-thioxo-thiazolidin-4-on |
| 3-Ethyl-5-[2-(3-methylthiazolidin-2-ylidene)ethylidene]-2-thioxo-4-thiazolidinone |