p-Aniline-MMAE structure
|
Common Name | p-Aniline-MMAE | ||
|---|---|---|---|---|
| CAS Number | 2748039-81-6 | Molecular Weight | 867.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C47H74N6O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of p-Aniline-MMAEp-Aniline-MMAE is a p-Aniline conjugated monomethyl auristatin E (MMAE). p-Aniline-MMAE can be used in the synthesis of ADC[1]. |
| Name | p-Aniline-MMAE |
|---|
| Description | p-Aniline-MMAE is a p-Aniline conjugated monomethyl auristatin E (MMAE). p-Aniline-MMAE can be used in the synthesis of ADC[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C47H74N6O9 |
|---|---|
| Molecular Weight | 867.13 |
| InChIKey | QUPYUWKTQZTKFW-AJZWWWJRSA-N |
| SMILES | CCC(C)C(C(CC(=O)N1CCCC1C(OC)C(C)C(=O)NC(C)C(O)c1ccccc1)OC)N(C)C(=O)C(NC(=O)C(C(C)C)N(C)C(=O)OCc1ccc(N)cc1)C(C)C |