(4-methoxyphenyl) 2,2-dichloroacetate structure
|
Common Name | (4-methoxyphenyl) 2,2-dichloroacetate | ||
|---|---|---|---|---|
| CAS Number | 26921-58-4 | Molecular Weight | 235.06400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methoxyphenyl) 2,2-dichloroacetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8Cl2O3 |
|---|---|
| Molecular Weight | 235.06400 |
| Exact Mass | 233.98500 |
| PSA | 35.53000 |
| LogP | 2.40430 |
| InChIKey | FYSUBKYBGWIHKT-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC(=O)C(Cl)Cl)cc1 |
|
~%
(4-methoxypheny... CAS#:26921-58-4 |
| Literature: Neuvonen, Helmi; Neuvonen, Kari Journal of the Chemical Society. Perkin Transactions 2, 1999 , # 7 p. 1497 - 1502 |
| Precursor 2 | |
|---|---|
| DownStream 2 | |
| Dichloroacetic acid,4-methoxyphenyl ester |
| p-methoxyphenyl dichloroacetate |
| Acetic acid,dichloro-,4-methoxyphenyl ester |
| 4-methoxyphenyl-2,2-dichloroethanoate |
| (4-Methoxy-phenyl)-dichloracetat |
| p-methoxyphenyl dichloroethanoate |
| 4-methoxyphenyl dichloroacetate |
| p-methoxyphenyl 2,2-dichloroacetate |
| p-Methoxyphenyldichloracetat |