3-acetyl-2-methyl-4-phenyl-1,4-dihydroindeno[1,2-b]pyridin-5-one structure
|
Common Name | 3-acetyl-2-methyl-4-phenyl-1,4-dihydroindeno[1,2-b]pyridin-5-one | ||
|---|---|---|---|---|
| CAS Number | 26576-80-7 | Molecular Weight | 315.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-acetyl-2-methyl-4-phenyl-1,4-dihydroindeno[1,2-b]pyridin-5-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H17NO2 |
|---|---|
| Molecular Weight | 315.36500 |
| Exact Mass | 315.12600 |
| PSA | 46.17000 |
| LogP | 4.17280 |
| InChIKey | HPIIQBIZUYHMQI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C)NC2=C(C(=O)c3ccccc32)C1c1ccccc1 |
|
~%
3-acetyl-2-meth... CAS#:26576-80-7 |
| Literature: Safak; Simsek; Altas; Boydag; Erol Bollettino Chimico Farmaceutico, 1997 , vol. 136, # 11 p. 665 - 669 |
|
~%
3-acetyl-2-meth... CAS#:26576-80-7 |
| Literature: Petrow; Saper; Sturgeon Journal of the Chemical Society, 1949 , p. 2134,2136 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 3-Acetyl-2-methyl-4-phenyl-1,4-dihydro-indeno[1,2-b]pyridin-5-on |
| 3-acetyl-2-methyl-4-phenyl-1,4-dihydro-indeno[1,2-b]pyridin-5-one |
| 3-Acetyl-2-methyl-4-phenyl-5-oxo-4,5-dihydro-1H-indeno<1,2-b>pyridine |
| HMS2693B23 |