4-[2-(4-bromophenyl)ethenyl]-1-methylpyridin-1-ium,iodide structure
|
Common Name | 4-[2-(4-bromophenyl)ethenyl]-1-methylpyridin-1-ium,iodide | ||
|---|---|---|---|---|
| CAS Number | 26467-86-7 | Molecular Weight | 402.06800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13BrIN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(4-bromophenyl)ethenyl]-1-methylpyridin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13BrIN |
|---|---|
| Molecular Weight | 402.06800 |
| Exact Mass | 400.92800 |
| PSA | 4.93000 |
| InChIKey | UFYIXCJJBBKNTM-SQQVDAMQSA-M |
| SMILES | C[n+]1ccc(C=Cc2ccc(Br)cc2)cc1.[I-] |
|
~%
4-[2-(4-bromoph... CAS#:26467-86-7 |
| Literature: Rosania, Gustavo R.; Lee, Jae Wook; Ding, Liang; Yoon, Hai-Shin; Chang, Young-Tae Journal of the American Chemical Society, 2003 , vol. 125, # 5 p. 1130 - 1131 |
|
~%
4-[2-(4-bromoph... CAS#:26467-86-7 |
| Literature: Rosania, Gustavo R.; Lee, Jae Wook; Ding, Liang; Yoon, Hai-Shin; Chang, Young-Tae Journal of the American Chemical Society, 2003 , vol. 125, # 5 p. 1130 - 1131 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Pyridinium,4-[2-(4-bromophenyl)ethenyl]-1-methyl-,iodide |
| GNF-Pf-5043 |
| 1-methyl-4-(4'-Br-styryl) pyridinium iodide |