sodium,(Z)-4-hydroxy-4-oxobut-2-enoate,methoxyethene
Modify Date: 2024-01-11 11:02:09
sodium,(Z)-4-hydroxy-4-oxobut-2-enoate,methoxyethene structure
|
Common Name | sodium,(Z)-4-hydroxy-4-oxobut-2-enoate,methoxyethene | ||
|---|---|---|---|---|
| CAS Number | 26300-19-6 | Molecular Weight | 196.13300 | |
| Density | N/A | Boiling Point | 355.5ºC at 760 mmHg | |
| Molecular Formula | C7H9NaO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
| Name | sodium,(Z)-4-hydroxy-4-oxobut-2-enoate,methoxyethene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 355.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C7H9NaO5 |
| Molecular Weight | 196.13300 |
| Flash Point | 183ºC |
| Exact Mass | 196.03500 |
| PSA | 86.66000 |
| Vapour Pressure | 5.19E-06mmHg at 25°C |
| InChIKey | XCLFWMFIYAIXEG-UAIGNFCESA-M |
| SMILES | C=COC.O=C([O-])C=CC(=O)O.[Na+] |
| 2-Butenedioic acid (Z)-,polymer with methoxyethene,sodium salt |
| 2-Butenedioic acid (2Z)-,polymer with methoxyethene,sodium salt |