dichloro(dimethyl)silane,trichloro(methyl)silane,trichloro(phenyl)silane
Modify Date: 2025-08-25 12:20:03
dichloro(dimethyl)silane,trichloro(methyl)silane,trichloro(phenyl)silane structure
|
Common Name | dichloro(dimethyl)silane,trichloro(methyl)silane,trichloro(phenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 25766-16-9 | Molecular Weight | 490.08800 | |
| Density | N/A | Boiling Point | 201ºC at 760mmHg | |
| Molecular Formula | C9H14Cl8Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.5ºC | |
| Name | dichloro(dimethyl)silane,trichloro(methyl)silane,trichloro(phenyl)silane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 201ºC at 760mmHg |
|---|---|
| Molecular Formula | C9H14Cl8Si3 |
| Molecular Weight | 490.08800 |
| Flash Point | 87.5ºC |
| Exact Mass | 485.79100 |
| LogP | 6.98620 |
| Vapour Pressure | 0.447mmHg at 25°C |
| InChIKey | DNEPOUYUYHCPTN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)Cl.C[Si](Cl)(Cl)Cl.Cl[Si](Cl)(Cl)c1ccccc1 |
| Silane,dichlorodimethyl-,polymer with trichloromethylsilane and trichlorophenylsilane |
| trichloro-phenyl-silane |
| Silane,trichlorophenyl-,polymer with dichlorodimethylsilane and trichloromethylsilane |
| trichloro-methyl-silane |