3-methyl-4-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazol-5-one structure
|
Common Name | 3-methyl-4-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazol-5-one | ||
|---|---|---|---|---|
| CAS Number | 2554-35-0 | Molecular Weight | 216.23900 | |
| Density | 1.29g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-4-[(4-methylphenyl)diazenyl]-1,4-dihydropyrazol-5-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.23900 |
| Exact Mass | 216.10100 |
| PSA | 69.67000 |
| LogP | 1.66450 |
| Index of Refraction | 1.648 |
| InChIKey | IEHUIUFRCOTUPN-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=O)C1N=Nc1ccc(C)cc1 |
|
~%
3-methyl-4-[(4-... CAS#:2554-35-0 |
| Literature: Shukla, P. R.; Srivastava, Chandreshwari Journal of the Indian Chemical Society, 1981 , vol. 58, p. 937 - 939 |
|
~%
3-methyl-4-[(4-... CAS#:2554-35-0 |
| Literature: Shukla, P. R.; Srivastava, Chandreshwari Journal of the Indian Chemical Society, 1981 , vol. 58, p. 937 - 939 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3H-Pyrazol-3-one,2,4-dihydro-5-methyl-4-((4-methylphenyl)azo) |
| 3-Methyl-4-(p-tolylazo)-2-pyrazolin-5-one |
| 4-(4'Tolyl-azo)-3-methyl-pyrazolon-(5) |
| F 2342 |
| 4-(4'Tolyl-azo)-3-methyl-pyrazolon-(5) [German] |
| 2-Pyrazolin-5-one,3-methyl-4-(p-tolylazo) |
| 3-methyl-4-(p-methylphenylazo)pyrazole-5-one |