4-Chloro-5-(ethylsulfanyl)-2-phenyl-3(2H)-pyridazinone structure
|
Common Name | 4-Chloro-5-(ethylsulfanyl)-2-phenyl-3(2H)-pyridazinone | ||
|---|---|---|---|---|
| CAS Number | 25381-21-9 | Molecular Weight | 266.74700 | |
| Density | 1.3g/cm3 | Boiling Point | 351.6ºC at 760 mmHg | |
| Molecular Formula | C12H11ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Chloro-5-(ethylsulfanyl)-2-phenyl-3(2H)-pyridazinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 351.6ºC at 760 mmHg |
| Molecular Formula | C12H11ClN2OS |
| Molecular Weight | 266.74700 |
| Exact Mass | 266.02800 |
| PSA | 60.19000 |
| LogP | 2.99790 |
| Vapour Pressure | 4.06E-05mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | TVIBWFLNOPASNJ-UHFFFAOYSA-N |
| SMILES | CCSc1cnn(-c2ccccc2)c(=O)c1Cl |
| HS Code | 2933990090 |
|---|
|
~84%
4-Chloro-5-(eth... CAS#:25381-21-9 |
| Literature: Lyga, John W. Journal of Heterocyclic Chemistry, 1988 , vol. 25, p. 1757 - 1760 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-5-ethylsulfanyl-2-phenyl-2H-pyridazin-3-one |