1-(10-methylphenothiazin-2-yl)ethanone structure
|
Common Name | 1-(10-methylphenothiazin-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 25324-52-1 | Molecular Weight | 255.33500 | |
| Density | 1.226g/cm3 | Boiling Point | 444.1ºC at 760mmHg | |
| Molecular Formula | C15H13NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.4ºC | |
| Name | 1-(10-methylphenothiazin-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 444.1ºC at 760mmHg |
| Molecular Formula | C15H13NOS |
| Molecular Weight | 255.33500 |
| Flash Point | 222.4ºC |
| Exact Mass | 255.07200 |
| PSA | 45.61000 |
| LogP | 4.18670 |
| Vapour Pressure | 4.39E-08mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | DGQXIDAJSBKRMJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)N(C)c1ccccc1S2 |
| HS Code | 2934300000 |
|---|
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-acetyl-N-methylphenothiazine |
| 1-(10-methyl-phenothiazin-2-yl)-ethanone |
| 1-(10-methyl-10H-phenothiazin-2-yl)ethanone |
| 1-(10-Methyl-phenothiazin-2-yl)-aethanon |
| 2-acetyl-10-methyl-phenothiazine |
| 1-(10-Methyl-10H-phenothiazin-2-yl)ethan-1-one |