4-ethyl-2-methylideneoctanoic acid,prop-2-enoic acid,styrene structure
|
Common Name | 4-ethyl-2-methylideneoctanoic acid,prop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 25085-19-2 | Molecular Weight | 360.48700 | |
| Density | N/A | Boiling Point | 285.9ºC at 760 mmHg | |
| Molecular Formula | C22H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192ºC | |
| Name | 4-ethyl-2-methylideneoctanoic acid,prop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 285.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.48700 |
| Flash Point | 192ºC |
| Exact Mass | 360.23000 |
| PSA | 74.60000 |
| LogP | 5.82030 |
| Vapour Pressure | 0.000702mmHg at 25°C |
| InChIKey | NZHBQEWIMRRYFF-UHFFFAOYSA-N |
| SMILES | C=C(CC(CC)CCCC)C(=O)O.C=CC(=O)O.C=Cc1ccccc1 |
| 4-ethyl-2-methylideneoctanoic acid |
| Styrene,acrylic acid,2-ethylhexyl acrylate polymer |
| 2-Propenoic acid,polymer with ethenylbenzene and 2-ethylhexyl 2-propenoate |