3-(2-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one
Modify Date: 2025-08-21 13:49:42
3-(2-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | 3-(2-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 23522-48-7 | Molecular Weight | 257.76000 | |
| Density | 1.5g/cm3 | Boiling Point | 354.3ºC at 760mmHg | |
| Molecular Formula | C10H8ClNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1ºC | |
| Name | 3-(2-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 354.3ºC at 760mmHg |
| Molecular Formula | C10H8ClNOS2 |
| Molecular Weight | 257.76000 |
| Flash Point | 168.1ºC |
| Exact Mass | 256.97400 |
| PSA | 77.70000 |
| LogP | 3.15820 |
| Vapour Pressure | 3.38E-05mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | LGUPLRAIWPKAKF-UHFFFAOYSA-N |
| SMILES | CC1SC(=S)N(c2ccccc2Cl)C1=O |
|
~2%
3-(2-chlorophen... CAS#:23522-48-7 |
| Literature: Aydeniz, Yeliz; Oguz, Funda; Yaman, Arzu; Konuklar, Aylin Sungur; Dogan, Ilknur; Aviyente, Viktorya; Klein, Roger A. Organic and Biomolecular Chemistry, 2004 , vol. 2, # 17 p. 2426 - 2436 |
|
~%
3-(2-chlorophen... CAS#:23522-48-7 |
| Literature: Aydeniz, Yeliz; Oguz, Funda; Yaman, Arzu; Konuklar, Aylin Sungur; Dogan, Ilknur; Aviyente, Viktorya; Klein, Roger A. Organic and Biomolecular Chemistry, 2004 , vol. 2, # 17 p. 2426 - 2436 |
![[(2-chlorophenyl)amino]methanedithioic acid structure](https://image.chemsrc.com/caspic/169/66065-30-3.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |