propyl N-[3-(dimethylamino)propyl]carbamate,2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile,hydrochloride structure
|
Common Name | propyl N-[3-(dimethylamino)propyl]carbamate,2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 226214-37-5 | Molecular Weight | 490.63900 | |
| Density | N/A | Boiling Point | 350.5ºC at 760 mmHg | |
| Molecular Formula | C17H21Cl5N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.8ºC | |
| Name | propyl N-[3-(dimethylamino)propyl]carbamate,2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 350.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H21Cl5N4O2 |
| Molecular Weight | 490.63900 |
| Flash Point | 153.8ºC |
| Exact Mass | 488.01100 |
| PSA | 92.64000 |
| LogP | 6.12426 |
| Vapour Pressure | 4.36E-05mmHg at 25°C |
| InChIKey | BNYAUCNTUBJZDY-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)NCCCN(C)C.Cl.N#Cc1c(Cl)c(Cl)c(Cl)c(C#N)c1Cl |
| 1,3-Benzenedicarbonitrile,2,4,5,6-tetrachloro-,mixed with propyl (3-(dimethylamino)propyl)carbamate,hydrochloride |
| Tattoo C |
| propyl N-[3-(dimethylamino)propyl]carbamate |
| Carbamic acid,(3-(dimethylamino)propyl)-,propyl ester,monohydrochloride,mixt. With 2,4,5,6-tetrachloro-1,3-benzenedicarbonitrile |
| 1,3-Benzenedicarbonitrile,2,4,5,6-tetrachloro-,mixt. with propyl (3-(dimethylamino)propylcarbamate |