Immune cell migration-IN-2 structure
|
Common Name | Immune cell migration-IN-2 | ||
|---|---|---|---|---|
| CAS Number | 2260679-24-9 | Molecular Weight | 594.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22Cl2NO7PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Immune cell migration-IN-2Immune cell migration-IN-2 is a potent immune cell migration inhibitor with an EC50 of 13.5 nM in a T-cell adhesion assay. Immune cell migration-IN-2 is extracted from patent WO2019001171, example 11, can be used for dry-eye and other retinal diseases research[1]. |
| Name | Immune cell migration-IN-2 |
|---|
| Description | Immune cell migration-IN-2 is a potent immune cell migration inhibitor with an EC50 of 13.5 nM in a T-cell adhesion assay. Immune cell migration-IN-2 is extracted from patent WO2019001171, example 11, can be used for dry-eye and other retinal diseases research[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H22Cl2NO7PS |
|---|---|
| Molecular Weight | 594.40 |
| InChIKey | GFOAULRGMIKMSB-FZBBVYCTSA-N |
| SMILES | CP(=O)(C#Cc1cc(Cl)c(C(=O)NC(Cc2cccc(S(C)(=O)=O)c2)C(=O)O)c(Cl)c1)c1cccc(O)c1 |