5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzamide
Modify Date: 2025-09-11 13:26:55
![5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzamide Structure](https://image.chemsrc.com/caspic/009/22560-59-4.png)
5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzamide structure
|
Common Name | 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 22560-59-4 | Molecular Weight | 252.30900 | |
| Density | 1.187g/cm3 | Boiling Point | 442.9ºC at 760mmHg | |
| Molecular Formula | C13H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.7ºC | |
| Name | 5-[2-(tert-butylamino)-1-hydroxyethyl]-2-hydroxybenzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 442.9ºC at 760mmHg |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.30900 |
| Flash Point | 221.7ºC |
| Exact Mass | 252.14700 |
| PSA | 96.57000 |
| LogP | 2.18770 |
| Vapour Pressure | 1.26E-08mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | XJSJWMNGCFMVJB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(O)c1ccc(O)c(C(N)=O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-(2-tert-butylamino-hydroxyethyl)-salicylamide |
| Salicylamide,5-(2-(tert-butylamino)-1-hydroxyethyl) |
| 5-(2-tert-Butylamino-1-hydroxyethyl)-salicylamid |
| 5-(2-(tert-Butylamino)-1-hydroxyethyl)salicylamide |
| AH 3474 |