GPR35 agonist 5
Modify Date: 2025-08-25 12:14:18
GPR35 agonist 5 structure
|
Common Name | GPR35 agonist 5 | ||
|---|---|---|---|---|
| CAS Number | 2226201-24-5 | Molecular Weight | 318.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GPR35 agonist 5GPR35 agonist 5 (3,5-dinitro-bisphenol A; compound 6) is a weak GPR35 agonist. GPR35 agonist 5 arrests CHO-S cells at the G1/Gophase[1]. |
| Name | GPR35 agonist 5 |
|---|
| Description | GPR35 agonist 5 (3,5-dinitro-bisphenol A; compound 6) is a weak GPR35 agonist. GPR35 agonist 5 arrests CHO-S cells at the G1/Gophase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H14N2O6 |
|---|---|
| Molecular Weight | 318.28 |
| InChIKey | RMOCKJKLZTYVLR-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccc(O)cc1)c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |