6,7-Diethoxy-4-oxo-1,4-dihydro-3-quinolinecarbonitrile structure
|
Common Name | 6,7-Diethoxy-4-oxo-1,4-dihydro-3-quinolinecarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 214476-70-7 | Molecular Weight | 258.27300 | |
| Density | 1.257g/cm3 | Boiling Point | 409.467ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.439ºC | |
| Name | 6,7-Diethoxy-4-oxo-1,4-dihydro-3-quinolinecarbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 409.467ºC at 760 mmHg |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.27300 |
| Flash Point | 201.439ºC |
| Exact Mass | 258.10000 |
| PSA | 75.11000 |
| LogP | 2.19718 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.583 |
| InChIKey | PCONYILKRARXQK-UHFFFAOYSA-N |
| SMILES | CCOc1cc2[nH]cc(C#N)c(=O)c2cc1OCC |
|
~%
6,7-Diethoxy-4-... CAS#:214476-70-7 |
| Literature: Wyeth Holdings Corporation Patent: EP973746 B1, 2003 ; Location in patent: Page/Page column 82 ; EP 0973746 B1 |
|
~%
6,7-Diethoxy-4-... CAS#:214476-70-7 |
| Literature: Wissner; Berger; Boschelli; Brawner Floyd Jr.; Greenberger; Gruber; Johnson; Mamuya; Nilakantan; Reich; Shen; Tsou; Upeslacis; Yu Fen Wang; Wu; Ye; Zhang Journal of Medicinal Chemistry, 2000 , vol. 43, # 17 p. 3244 - 3256 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 1,4-dihydroquinoline-6,7-diethoxy-4-oxo-3-carbonitrile |
| 1,4-dihydropyran |