ethyl (4-chloro-3-methylphenyl)carbamothioylsulfanylformate structure
|
Common Name | ethyl (4-chloro-3-methylphenyl)carbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 20975-53-5 | Molecular Weight | 289.80100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12ClNO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl (4-chloro-3-methylphenyl)carbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12ClNO2S2 |
|---|---|
| Molecular Weight | 289.80100 |
| Exact Mass | 289.00000 |
| PSA | 95.72000 |
| LogP | 4.30790 |
| Vapour Pressure | 5.83E-06mmHg at 25°C |
| InChIKey | JELMLFVNIOYLKR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)Nc1ccc(Cl)c(C)c1 |
| Carbonic acid,thio-,anhydrosulfide with 4-chloro-3-methyldithiocarbanilic acid,ethyl ester |
| Thiocarbonic acid anhydrosulfide with 4-chloro-3-methyldithiocarbanilic acid ethyl ester |