Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2R,3R)-, compd. with 1,1-dimethylethyl (2R)-2-ethynyl-2-methyl-1-pyrrolidineacetate (1:1) structure
|
Common Name | Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2R,3R)-, compd. with 1,1-dimethylethyl (2R)-2-ethynyl-2-methyl-1-pyrrolidineacetate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 2086689-89-4 | Molecular Weight | 609.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H39NO10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Butanedioic acid, 2,3-bis[(4-methylbenzoyl)oxy]-, (2R,3R)-, compd. with 1,1-dimethylethyl (2R)-2-ethynyl-2-methyl-1-pyrrolidineacetate (1:1) |
|---|
| Molecular Formula | C33H39NO10 |
|---|---|
| Molecular Weight | 609.7 |
| InChIKey | KCUULTYYLMTIGX-GCAOVTBYSA-N |
| SMILES | C#CC1(C)CCCN1CC(=O)OC(C)(C)C.Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |