2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine structure
|
Common Name | 2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine | ||
|---|---|---|---|---|
| CAS Number | 2078-06-0 | Molecular Weight | 275.31300 | |
| Density | 1.189g/cm3 | Boiling Point | 364.4ºC at 760 mmHg | |
| Molecular Formula | C13H20F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.2ºC | |
| Name | 2-N,2-N-dipropyl-5-(trifluoromethyl)benzene-1,2,3-triamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.189g/cm3 |
|---|---|
| Boiling Point | 364.4ºC at 760 mmHg |
| Molecular Formula | C13H20F3N3 |
| Molecular Weight | 275.31300 |
| Flash Point | 174.2ºC |
| Exact Mass | 275.16100 |
| PSA | 55.28000 |
| LogP | 4.65860 |
| Vapour Pressure | 1.68E-05mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | XNOWGHDYQLSREX-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)c1c(N)cc(C(F)(F)F)cc1N |
| HS Code | 2921590090 |
|---|
|
~%
2-N,2-N-dipropy... CAS#:2078-06-0 |
| Literature: Strynar, Mark; Dec, Jerzy; Benesi, Alan; Jones, A. Daniel; Fry, Roderick A.; Bollag, Jean-Marc Environmental Science and Technology, 2004 , vol. 38, # 24 p. 6645 - 6655 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,6-Diamino-4-trifluormethyl-N,N-dipropylanilin |