3-(3-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one structure
|
Common Name | 3-(3-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 20518-22-3 | Molecular Weight | 257.76000 | |
| Density | 1.5g/cm3 | Boiling Point | 372.1ºC at 760 mmHg | |
| Molecular Formula | C10H8ClNOS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.8ºC | |
| Name | 3-(3-chlorophenyl)-5-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 372.1ºC at 760 mmHg |
| Molecular Formula | C10H8ClNOS2 |
| Molecular Weight | 257.76000 |
| Flash Point | 178.8ºC |
| Exact Mass | 256.97400 |
| PSA | 77.70000 |
| LogP | 3.15820 |
| Vapour Pressure | 9.85E-06mmHg at 25°C |
| Index of Refraction | 1.71 |
| InChIKey | RYHYCGDCWBJCTO-UHFFFAOYSA-N |
| SMILES | CC1SC(=S)N(c2cccc(Cl)c2)C1=O |
|
~%
3-(3-chlorophen... CAS#:20518-22-3 |
| Literature: Werbel; Headen; Elslager Journal of medicinal chemistry, 1968 , vol. 11, # 2 p. 364 - 365 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |