4-(methylamino)-2,6-dinitrophenol
Modify Date: 2025-09-03 15:42:19
4-(methylamino)-2,6-dinitrophenol structure
|
Common Name | 4-(methylamino)-2,6-dinitrophenol | ||
|---|---|---|---|---|
| CAS Number | 20291-98-9 | Molecular Weight | 213.14800 | |
| Density | 1.627g/cm3 | Boiling Point | 302.4ºC at 760mmHg | |
| Molecular Formula | C7H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.7ºC | |
| Name | 4-(methylamino)-2,6-dinitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.627g/cm3 |
|---|---|
| Boiling Point | 302.4ºC at 760mmHg |
| Molecular Formula | C7H7N3O5 |
| Molecular Weight | 213.14800 |
| Flash Point | 136.7ºC |
| Exact Mass | 213.03900 |
| PSA | 123.90000 |
| LogP | 2.36970 |
| Vapour Pressure | 0.000553mmHg at 25°C |
| Index of Refraction | 1.703 |
| InChIKey | RHHQGGGEFAQZLY-UHFFFAOYSA-N |
| SMILES | CNc1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| EINECS 243-695-8 |
| N-Methyl-isopikraminsaeure |
| 1-hydroxy-2,6-dinitro-4-methylaminobenzene |
| N-methyl-isopicramic acid |