2,4,6-tritert-butylbenzoyl chloride structure
|
Common Name | 2,4,6-tritert-butylbenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 20208-55-3 | Molecular Weight | 308.88600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29ClO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,4,6-tritert-butylbenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H29ClO |
|---|---|
| Molecular Weight | 308.88600 |
| Exact Mass | 308.19100 |
| PSA | 17.07000 |
| LogP | 5.95810 |
| InChIKey | LILHQIIHOWEMEY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(=O)Cl)c(C(C)(C)C)c1 |
|
~89%
2,4,6-tritert-b... CAS#:20208-55-3 |
| Literature: Schweiger, Martin J.; Nagel, Ulrich; Beck, Wolfgang Journal of Organometallic Chemistry, 1988 , vol. 355, p. 289 - 296 |
|
~%
2,4,6-tritert-b... CAS#:20208-55-3 |
| Literature: Davies, Alwyn G.; Sutcliffe, Roger Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 819 - 824 |
|
~%
2,4,6-tritert-b... CAS#:20208-55-3 |
| Literature: Davies, Alwyn G.; Sutcliffe, Roger Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1980 , p. 819 - 824 |
| 2,4,6-tri-t-butylbenzoyl chloride |
| 2,4,6-Tri-tert-butylbenzoyl chloride |
| 2,4,6-tri-t-butylphenyl-COCl |
| 2,4,6-tri-tert-butylperbenzoyl chloride |
| 2,4,6-tert-butylbenzoyl chloride |