2,3,5-trifluoro-4,6-bis(trifluoromethyl)benzenethiol structure
|
Common Name | 2,3,5-trifluoro-4,6-bis(trifluoromethyl)benzenethiol | ||
|---|---|---|---|---|
| CAS Number | 2010-75-5 | Molecular Weight | 300.14400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8HF9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5-trifluoro-4,6-bis(trifluoromethyl)benzenethiol |
|---|
| Molecular Formula | C8HF9S |
|---|---|
| Molecular Weight | 300.14400 |
| Exact Mass | 299.96600 |
| PSA | 38.80000 |
| LogP | 4.43020 |
| InChIKey | LMYHNMRHEFUIPG-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(C(F)(F)F)c1S |
| HS Code | 2930909090 |
|---|
|
~%
2,3,5-trifluoro... CAS#:2010-75-5 |
| Literature: Aroskar,E.V. et al. Journal of the Chemical Society, 1965 , p. 2658 - 2661 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |