4-methyl-2-naphthalen-1-yl-2-(2-piperidin-1-ylethyl)pentanamide structure
|
Common Name | 4-methyl-2-naphthalen-1-yl-2-(2-piperidin-1-ylethyl)pentanamide | ||
|---|---|---|---|---|
| CAS Number | 19886-65-8 | Molecular Weight | 352.51300 | |
| Density | 1.27g/cm3 | Boiling Point | 597.5ºC at 760 mmHg | |
| Molecular Formula | C23H32N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.9ºC | |
| Name | 4-methyl-2-naphthalen-1-yl-2-(2-piperidin-1-ylethyl)pentanamide |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 597.5ºC at 760 mmHg |
| Molecular Formula | C23H32N2O |
| Molecular Weight | 352.51300 |
| Flash Point | 189.9ºC |
| Exact Mass | 352.25100 |
| PSA | 47.32000 |
| LogP | 5.57260 |
| Vapour Pressure | 9.04E-17mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | ZTWWQCOHUBHIGI-QNFQAGAISA-N |
| SMILES | CC(=O)OCC(=O)C1CCC2(O)C3CCC4(O)CC(OC(C)=O)CCC4(COC(C)=O)C3CCC12C |
|
~%
4-methyl-2-naph... CAS#:19886-65-8 |
| Literature: Oliveto et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 2831 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |