1-chloro-4-[1-(4-chlorophenyl)-2,2-dimethylpropyl]benzene structure
|
Common Name | 1-chloro-4-[1-(4-chlorophenyl)-2,2-dimethylpropyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 19685-37-1 | Molecular Weight | 293.23100 | |
| Density | 1.129g/cm3 | Boiling Point | 366.7ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.8ºC | |
| Name | 1-chloro-4-[1-(4-chlorophenyl)-2,2-dimethylpropyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.129g/cm3 |
|---|---|
| Boiling Point | 366.7ºC at 760 mmHg |
| Molecular Formula | C17H18Cl2 |
| Molecular Weight | 293.23100 |
| Flash Point | 152.8ºC |
| Exact Mass | 292.07900 |
| LogP | 6.17140 |
| Vapour Pressure | 3.03E-05mmHg at 25°C |
| Index of Refraction | 1.559 |
| InChIKey | RGTVOBGKRIUBJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
|
~%
1-chloro-4-[1-(... CAS#:19685-37-1 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1950 , p. 2718,2721 |
|
~%
1-chloro-4-[1-(... CAS#:19685-37-1 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1952 , p. 2806,2808 |
|
~%
1-chloro-4-[1-(... CAS#:19685-37-1 |
| Literature: Skerrett; Woodcock Journal of the Chemical Society, 1950 , p. 2718,2721 |
| Benzene,1,1'-(2,2-dimethylpropylidene)bis(4-chloro |
| 1,1-Bis-(4-chlor-phenyl)-2,2-dimethyl-propan |
| 1,1-bis-(4-chloro-phenyl)-2,2-dimethyl-propane |
| 1,1'-(2,2-Dimethylpropylidene)bis(4-chlorobenzene) |
| 4,4'-(2,2-DIMETHYLPROPANE-1,1-DIYL)BIS(CHLOROBENZENE) |
| 1,1'-(2,2-dimethylpropane-1,1-diyl)bis(4-chlorobenzene) |