Iron, (L-ascorbato)(dihydrogen phosphato)-, cyclic 2a(2),3a(2)-ester with adenosine structure
|
Common Name | Iron, (L-ascorbato)(dihydrogen phosphato)-, cyclic 2a(2),3a(2)-ester with adenosine | ||
|---|---|---|---|---|
| CAS Number | 19040-05-2 | Molecular Weight | 561.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20FeN5O12P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Iron, (L-ascorbato)(dihydrogen phosphato)-, cyclic 2a(2),3a(2)-ester with adenosine |
|---|
| Molecular Formula | C16H20FeN5O12P |
|---|---|
| Molecular Weight | 561.17 |
| InChIKey | WTGHPMDMVYDEEA-DHMHAUCOSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)C2OP(=O)(O)OC21.O=C1OC(C(O)CO)C(O)=C1O.[Fe] |