6,8-dimethyl-2H-pyrimido[5,4-e][1,2,4]triazine-3,5,7-trione structure
|
Common Name | 6,8-dimethyl-2H-pyrimido[5,4-e][1,2,4]triazine-3,5,7-trione | ||
|---|---|---|---|---|
| CAS Number | 18969-83-0 | Molecular Weight | 209.16200 | |
| Density | 1.83g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H7N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-dimethyl-2H-pyrimido[5,4-e][1,2,4]triazine-3,5,7-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.83g/cm3 |
|---|---|
| Molecular Formula | C7H7N5O3 |
| Molecular Weight | 209.16200 |
| Exact Mass | 209.05500 |
| PSA | 102.90000 |
| Index of Refraction | 1.803 |
| InChIKey | LTCRXRJDVYDZJL-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2nc(=O)[nH]nc2n(C)c1=O |
|
~99%
6,8-dimethyl-2H... CAS#:18969-83-0 |
| Literature: Azev; Aleksandrov Pharmaceutical Chemistry Journal, 2000 , vol. 34, # 9 p. 494 - 496 |
|
~44%
6,8-dimethyl-2H... CAS#:18969-83-0 |
| Literature: Azev Pharmaceutical Chemistry Journal, 1997 , vol. 31, # 1 p. 45 - 46 |
|
~%
6,8-dimethyl-2H... CAS#:18969-83-0 |
| Literature: Azev Pharmaceutical Chemistry Journal, 1997 , vol. 31, # 1 p. 45 - 46 |
|
~%
6,8-dimethyl-2H... CAS#:18969-83-0 |
| Literature: Azev, Yu. A.; Sidorov, E. O.; Mudretsova, I. I. Chemistry of Heterocyclic Compounds (New York, NY, United States), 1985 , vol. 21, # 12 p. 1396 Khimiya Geterotsiklicheskikh Soedinenii, 1985 , vol. 21, # 12 p. 1692 - 1693 |
| Precursor 4 | |
|---|---|
| DownStream 7 | |
| 6,8-dimethyl-3,5,7-trioxo-2,3,5,6,7,8-hexahydropyrimido[5,4-e][1,2,4]triazine |
| 3-Fervenulone |
| Fervenulone |
| Pyrimido(5,4-e)-1,2,4-triazine-3,5,7(6H)-trione,2,8-dihydro-6,8-dimethyl-(9CI) |
| fervenulin-3-one |
| 6,8-dimethyl-2,8-dihydro-pyrimido[5,4-e][1,2,4]triazine-3,5,7-trione |
| 6,8-Dimethyl-3-hydroxypyrimido(5,4-e)-as-triazine-5,7(6H,8H)-dione |
| phervenulin-3-one |
| Pyrimido(5,4-e)-as-triazine-5,7(6H,8H)-dione,6,8-dimethyl-3-hydroxy |
| 2,3,5,6,7,8-hexahydro-6,8-dimethylpyrimido<5,4-e>(1,2,4)-triazine-3,5,7-trione |