(fluoren-9-ylideneamino) 3,4,5-trimethoxybenzoate structure
|
Common Name | (fluoren-9-ylideneamino) 3,4,5-trimethoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 1866-76-8 | Molecular Weight | 389.40100 | |
| Density | 1.24g/cm3 | Boiling Point | 593.4ºC at 760 mmHg | |
| Molecular Formula | C23H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4ºC | |
| Name | (fluoren-9-ylideneamino) 3,4,5-trimethoxybenzoate |
|---|
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 593.4ºC at 760 mmHg |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.40100 |
| Flash Point | 249.4ºC |
| Exact Mass | 389.12600 |
| PSA | 66.35000 |
| LogP | 4.30220 |
| Vapour Pressure | 4.73E-14mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | PFLRYCWRRZNWHB-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)ON=C2c3ccccc3-c3ccccc32)cc(OC)c1OC |
|
~%
(fluoren-9-ylid... CAS#:1866-76-8 |
| Literature: Kochhar; Williams Journal of pharmaceutical sciences, 1965 , vol. 54, # 8 p. 1149 - 1152 |