5-phenyl-5H-benzo[b][1]benzosilole structure
|
Common Name | 5-phenyl-5H-benzo[b][1]benzosilole | ||
|---|---|---|---|---|
| CAS Number | 18557-54-5 | Molecular Weight | 258.38900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-phenyl-5H-benzo[b][1]benzosilole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14Si |
|---|---|
| Molecular Weight | 258.38900 |
| Exact Mass | 258.08600 |
| LogP | 1.91550 |
| InChIKey | KWDHGADFRGKQHH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)[SiH]2C3=CC=CC=C3C4=CC=CC=C42 |
|
~%
5-phenyl-5H-ben... CAS#:18557-54-5 |
| Literature: Gilman; Gorsich Journal of the American Chemical Society, 1958 , vol. 80, p. 3243,3244 |
|
~55%
5-phenyl-5H-ben... CAS#:18557-54-5 |
| Literature: Ishikawa, Mitsuo; Tabohashi, Tatsuru; Kumada, Makoto; Iyoda, Jun Journal of Organometallic Chemistry, 1984 , vol. 264, # 1-2 p. 79 - 86 |
| 9H-9-Silafluorene,9-phenyl |
| 9-Phenyl-9-silafluoren |
| 5-phenyl-5H-dibenzosilole |
| 9-phenyl-9,9-dihydro-9-silafluorene |
| 5-Phenyl-5H-dibenzosilol |
| 1-hydro-1-phenyldibenzosilole |