bis(2,5-dioxopyrrolidin-1-yl) cyclopropane-1,1-dicarboxylate structure
|
Common Name | bis(2,5-dioxopyrrolidin-1-yl) cyclopropane-1,1-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 184529-91-7 | Molecular Weight | 324.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis(2,5-dioxopyrrolidin-1-yl) cyclopropane-1,1-dicarboxylate |
|---|
| Molecular Formula | C13H12N2O8 |
|---|---|
| Molecular Weight | 324.24300 |
| Exact Mass | 324.05900 |
| PSA | 127.36000 |
| InChIKey | LXQLPRBDMSIPCV-UHFFFAOYSA-N |
| SMILES | O=C1CCC(=O)N1OC(=O)C1(C(=O)ON2C(=O)CCC2=O)CC1 |
|
~%
bis(2,5-dioxopy... CAS#:184529-91-7 |
| Literature: Bergeron, Raymond J.; Yao, Guo Wei; Erdos, Gregory W.; Milstein, Sam; Gao, Fenglan; Weimar, William R.; Phanstiel IV, Otto Journal of the American Chemical Society, 1995 , vol. 117, # 25 p. 6658 - 6665 |