6,7-Epoxy Docetaxel(Mixture of Diastereomers)
Modify Date: 2025-09-13 18:34:08
6,7-Epoxy Docetaxel(Mixture of Diastereomers) structure
|
Common Name | 6,7-Epoxy Docetaxel(Mixture of Diastereomers) | ||
|---|---|---|---|---|
| CAS Number | 181208-36-6 | Molecular Weight | 805.86334 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C43H51NO14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,7-Epoxy Docetaxel(Mixture of Diastereomers) |
|---|
| Molecular Formula | C43H51NO14 |
|---|---|
| Molecular Weight | 805.86334 |
| InChIKey | YIMIGTNUBJPFFC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC12COC1C1OC1C1(C)C(=O)C(O)C3=C(C)C(OC(=O)C(O)C(NC(=O)OC(C)(C)C)c4ccccc4)CC(O)(C(OC(=O)c4ccccc4)C21)C3(C)C |